C13H13FO3 — CID 11253337
2-fluoro-1,4,8-trimethoxynaphthalene (PubChem CID 11253337) has the molecular formula C13H13FO3 and a molecular weight of 236.24 g/mol. Its IUPAC name is 2-fluoro-1,4,8-trimethoxynaphthalene.
| Compound Name | 2-fluoro-1,4,8-trimethoxynaphthalene |
|---|---|
| PubChem CID | 11253337 |
| Molecular Formula | C13H13FO3 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-fluoro-1,4,8-trimethoxynaphthalene |
| SMILES | COc1cc(F)c(OC)c2c(OC)cccc12 |
| InChI | InChI=1S/C13H13FO3/c1-15-10-6-4-5-8-11(16-2)7-9(14)13(17-3)12(8)10/h4-7H,1-3H3 |
| InChIKey | DWNONOSKSMSAKO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |