C10H9FO2S — CID 130786112
2-fluoro-3,4-dimethoxy-1-benzothiophene (PubChem CID 130786112) has the molecular formula C10H9FO2S and a molecular weight of 212.24 g/mol. Its IUPAC name is 2-fluoro-3,4-dimethoxy-1-benzothiophene.
| Compound Name | 2-fluoro-3,4-dimethoxy-1-benzothiophene |
|---|---|
| PubChem CID | 130786112 |
| Molecular Formula | C10H9FO2S |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 2-fluoro-3,4-dimethoxy-1-benzothiophene |
| SMILES | COc1cccc2sc(F)c(OC)c12 |
| InChI | InChI=1S/C10H9FO2S/c1-12-6-4-3-5-7-8(6)9(13-2)10(11)14-7/h3-5H,1-2H3 |
| InChIKey | LBIWQZIUDWTTNH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |