C11H8O3S — CID 155577490
4-methoxy-1-benzothiophene-2,3-dicarbaldehyde (PubChem CID 155577490) has the molecular formula C11H8O3S and a molecular weight of 220.25 g/mol. Its IUPAC name is 4-methoxy-1-benzothiophene-2,3-dicarbaldehyde.
| Compound Name | 4-methoxy-1-benzothiophene-2,3-dicarbaldehyde |
|---|---|
| PubChem CID | 155577490 |
| Molecular Formula | C11H8O3S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 4-methoxy-1-benzothiophene-2,3-dicarbaldehyde |
| SMILES | COc1cccc2sc(C=O)c(C=O)c12 |
| InChI | InChI=1S/C11H8O3S/c1-14-8-3-2-4-9-11(8)7(5-12)10(6-13)15-9/h2-6H,1H3 |
| InChIKey | XGCNPUBAVJWEDY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|