C12H12O2S — CID 96607938
3-methoxy-4,5-dimethyl-1-benzothiophene-2-carbaldehyde (PubChem CID 96607938) has the molecular formula C12H12O2S and a molecular weight of 220.29 g/mol. Its IUPAC name is 3-methoxy-4,5-dimethyl-1-benzothiophene-2-carbaldehyde.
| Compound Name | 3-methoxy-4,5-dimethyl-1-benzothiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 96607938 |
| Molecular Formula | C12H12O2S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 3-methoxy-4,5-dimethyl-1-benzothiophene-2-carbaldehyde |
| SMILES | COc1c(C=O)sc2ccc(C)c(C)c12 |
| InChI | InChI=1S/C12H12O2S/c1-7-4-5-9-11(8(7)2)12(14-3)10(6-13)15-9/h4-6H,1-3H3 |
| InChIKey | FMUOFAAKBQBHOF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|