C26H22N2O3 — CID 11361877
11-(2,4,6-trimethoxyphenyl)benzo[c]phenanthridin-6-amine (PubChem CID 11361877) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is 11-(2,4,6-trimethoxyphenyl)benzo[c]phenanthridin-6-amine.
| Compound Name | 11-(2,4,6-trimethoxyphenyl)benzo[c]phenanthridin-6-amine |
|---|---|
| PubChem CID | 11361877 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 11-(2,4,6-trimethoxyphenyl)benzo[c]phenanthridin-6-amine |
| SMILES | COc1cc(OC)c(-c2cc3ccccc3c3nc(N)c4ccccc4c23)c(OC)c1 |
| InChI | InChI=1S/C26H22N2O3/c1-29-16-13-21(30-2)24(22(14-16)31-3)20-12-15-8-4-5-9-17(15)25-23(20)18-10-6-7-11-19(18)26(27)28-25/h4-14H,1-3H3,(H2,27,28) |
| InChIKey | YDRIEHNDYXKZTN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|