C22H22N4O2S2 — CID 139228012
N-methyl-4-[2-[2-[2-[2-(methylamino)-1,3-thiazol-4-yl]phenoxy]ethoxy]phenyl]-1,3-thiazol-2-amine (PubChem CID 139228012) has the molecular formula C22H22N4O2S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is N-methyl-4-[2-[2-[2-[2-(methylamino)-1,3-thiazol-4-yl]phenoxy]ethoxy]phenyl]-1,3-thiazol-2-amine.
| Compound Name | N-methyl-4-[2-[2-[2-[2-(methylamino)-1,3-thiazol-4-yl]phenoxy]ethoxy]phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 139228012 |
| Molecular Formula | C22H22N4O2S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-methyl-4-[2-[2-[2-[2-(methylamino)-1,3-thiazol-4-yl]phenoxy]ethoxy]phenyl]-1,3-thiazol-2-amine |
| SMILES | CNc1nc(-c2ccccc2OCCOc2ccccc2-c2csc(NC)n2)cs1 |
| InChI | InChI=1S/C22H22N4O2S2/c1-23-21-25-17(13-29-21)15-7-3-5-9-19(15)27-11-12-28-20-10-6-4-8-16(20)18-14-30-22(24-2)26-18/h3-10,13-14H,11-12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | WQGKHEHLNYLJDZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|