C11H12N2OS — CID 88788468
[2-[2-(methylamino)-1,3-thiazol-4-yl]phenyl]methanol (PubChem CID 88788468) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is [2-[2-(methylamino)-1,3-thiazol-4-yl]phenyl]methanol.
| Compound Name | [2-[2-(methylamino)-1,3-thiazol-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 88788468 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | [2-[2-(methylamino)-1,3-thiazol-4-yl]phenyl]methanol |
| SMILES | CNc1nc(-c2ccccc2CO)cs1 |
| InChI | InChI=1S/C11H12N2OS/c1-12-11-13-10(7-15-11)9-5-3-2-4-8(9)6-14/h2-5,7,14H,6H2,1H3,(H,12,13) |
| InChIKey | UCUOSCMODLASCK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |