C16H14N2O2S — CID 11254998
methyl 3-[2-(methylamino)-1,3-thiazol-4-yl]azulene-1-carboxylate (PubChem CID 11254998) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is methyl 3-[2-(methylamino)-1,3-thiazol-4-yl]azulene-1-carboxylate.
| Compound Name | methyl 3-[2-(methylamino)-1,3-thiazol-4-yl]azulene-1-carboxylate |
|---|---|
| PubChem CID | 11254998 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | methyl 3-[2-(methylamino)-1,3-thiazol-4-yl]azulene-1-carboxylate |
| SMILES | CNc1nc(-c2cc(C(=O)OC)c3cccccc2-3)cs1 |
| InChI | InChI=1S/C16H14N2O2S/c1-17-16-18-14(9-21-16)12-8-13(15(19)20-2)11-7-5-3-4-6-10(11)12/h3-9H,1-2H3,(H,17,18) |
| InChIKey | YNTWBCMCFMFKNN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |