C18H13FN2O3S — CID 60551769
methyl 4-[[4-(2-fluorophenyl)-1,3-thiazol-2-yl]carbamoyl]benzoate (PubChem CID 60551769) has the molecular formula C18H13FN2O3S and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl 4-[[4-(2-fluorophenyl)-1,3-thiazol-2-yl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[4-(2-fluorophenyl)-1,3-thiazol-2-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 60551769 |
| Molecular Formula | C18H13FN2O3S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | methyl 4-[[4-(2-fluorophenyl)-1,3-thiazol-2-yl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2nc(-c3ccccc3F)cs2)cc1 |
| InChI | InChI=1S/C18H13FN2O3S/c1-24-17(23)12-8-6-11(7-9-12)16(22)21-18-20-15(10-25-18)13-4-2-3-5-14(13)19/h2-10H,1H3,(H,20,21,22) |
| InChIKey | UGDGADHCLIDFLL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |