C20H17FN4O3S — CID 60551770
3,5-diacetamido-N-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 60551770) has the molecular formula C20H17FN4O3S and a molecular weight of 412.45 g/mol. Its IUPAC name is 3,5-diacetamido-N-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3,5-diacetamido-N-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 60551770 |
| Molecular Formula | C20H17FN4O3S |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 3,5-diacetamido-N-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2nc(-c3ccccc3F)cs2)c1 |
| InChI | InChI=1S/C20H17FN4O3S/c1-11(26)22-14-7-13(8-15(9-14)23-12(2)27)19(28)25-20-24-18(10-29-20)16-5-3-4-6-17(16)21/h3-10H,1-2H3,(H,22,26)(H,23,27)(H,24,25,28) |
| InChIKey | ZCSPFEJRRAEKME-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |