C16H11Cl2N3OS — CID 78868970
2,6-dichloro-N-[4-(2-methylphenyl)-1,3-thiazol-2-yl]pyridine-4-carboxamide (PubChem CID 78868970) has the molecular formula C16H11Cl2N3OS and a molecular weight of 364.26 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-(2-methylphenyl)-1,3-thiazol-2-yl]pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[4-(2-methylphenyl)-1,3-thiazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 78868970 |
| Molecular Formula | C16H11Cl2N3OS |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 2,6-dichloro-N-[4-(2-methylphenyl)-1,3-thiazol-2-yl]pyridine-4-carboxamide |
| SMILES | Cc1ccccc1-c1csc(NC(=O)c2cc(Cl)nc(Cl)c2)n1 |
| InChI | InChI=1S/C16H11Cl2N3OS/c1-9-4-2-3-5-11(9)12-8-23-16(19-12)21-15(22)10-6-13(17)20-14(18)7-10/h2-8H,1H3,(H,19,21,22) |
| InChIKey | PDITWTIPUAPXFH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|