C8H3BrF2N2S — CID 102943421
3-bromo-5-(2,6-difluorophenyl)-1,2,4-thiadiazole (PubChem CID 102943421) has the molecular formula C8H3BrF2N2S and a molecular weight of 277.09 g/mol. Its IUPAC name is 3-bromo-5-(2,6-difluorophenyl)-1,2,4-thiadiazole.
| Compound Name | 3-bromo-5-(2,6-difluorophenyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102943421 |
| Molecular Formula | C8H3BrF2N2S |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 275.92 |
| IUPAC Name | 3-bromo-5-(2,6-difluorophenyl)-1,2,4-thiadiazole |
| SMILES | Fc1cccc(F)c1-c1nc(Br)ns1 |
| InChI | InChI=1S/C8H3BrF2N2S/c9-8-12-7(14-13-8)6-4(10)2-1-3-5(6)11/h1-3H |
| InChIKey | GUMSTJQNWYDXDX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |