C9H6BrClN2S — CID 102943208
3-bromo-5-(3-chloro-5-methylphenyl)-1,2,4-thiadiazole (PubChem CID 102943208) has the molecular formula C9H6BrClN2S and a molecular weight of 289.59 g/mol. Its IUPAC name is 3-bromo-5-(3-chloro-5-methylphenyl)-1,2,4-thiadiazole.
| Compound Name | 3-bromo-5-(3-chloro-5-methylphenyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102943208 |
| Molecular Formula | C9H6BrClN2S |
| Molecular Weight | 289.59 g/mol |
| Exact Mass | 287.91 |
| IUPAC Name | 3-bromo-5-(3-chloro-5-methylphenyl)-1,2,4-thiadiazole |
| SMILES | Cc1cc(Cl)cc(-c2nc(Br)ns2)c1 |
| InChI | InChI=1S/C9H6BrClN2S/c1-5-2-6(4-7(11)3-5)8-12-9(10)13-14-8/h2-4H,1H3 |
| InChIKey | QTUVXJLORKBLED-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |