C10H10BrN3S — CID 102943222
4-(3-bromo-1,2,4-thiadiazol-5-yl)-N,N-dimethylaniline (PubChem CID 102943222) has the molecular formula C10H10BrN3S and a molecular weight of 284.18 g/mol. Its IUPAC name is 4-(3-bromo-1,2,4-thiadiazol-5-yl)-N,N-dimethylaniline.
| Compound Name | 4-(3-bromo-1,2,4-thiadiazol-5-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 102943222 |
| Molecular Formula | C10H10BrN3S |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 4-(3-bromo-1,2,4-thiadiazol-5-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc(Br)ns2)cc1 |
| InChI | InChI=1S/C10H10BrN3S/c1-14(2)8-5-3-7(4-6-8)9-12-10(11)13-15-9/h3-6H,1-2H3 |
| InChIKey | CSVYLQJCKMAPBG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |