C9H6BrFN2S — CID 102943436
3-bromo-5-(5-fluoro-2-methylphenyl)-1,2,4-thiadiazole (PubChem CID 102943436) has the molecular formula C9H6BrFN2S and a molecular weight of 273.13 g/mol. Its IUPAC name is 3-bromo-5-(5-fluoro-2-methylphenyl)-1,2,4-thiadiazole.
| Compound Name | 3-bromo-5-(5-fluoro-2-methylphenyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102943436 |
| Molecular Formula | C9H6BrFN2S |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 271.94 |
| IUPAC Name | 3-bromo-5-(5-fluoro-2-methylphenyl)-1,2,4-thiadiazole |
| SMILES | Cc1ccc(F)cc1-c1nc(Br)ns1 |
| InChI | InChI=1S/C9H6BrFN2S/c1-5-2-3-6(11)4-7(5)8-12-9(10)13-14-8/h2-4H,1H3 |
| InChIKey | ONDAKEZKXRCRLU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |