C19H20N2O4S3 — CID 133348701
2,4-bis(methylsulfonyl)-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]aniline (PubChem CID 133348701) has the molecular formula C19H20N2O4S3 and a molecular weight of 436.58 g/mol. Its IUPAC name is 2,4-bis(methylsulfonyl)-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]aniline.
| Compound Name | 2,4-bis(methylsulfonyl)-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 133348701 |
| Molecular Formula | C19H20N2O4S3 |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 2,4-bis(methylsulfonyl)-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]aniline |
| SMILES | CS(=O)(=O)c1ccc(NCCc2csc(-c3ccccc3)n2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H20N2O4S3/c1-27(22,23)16-8-9-17(18(12-16)28(2,24)25)20-11-10-15-13-26-19(21-15)14-6-4-3-5-7-14/h3-9,12-13,20H,10-11H2,1-2H3 |
| InChIKey | HTXYJVJSBCUTIF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |