C13H17N3O2S2 — CID 110624843
N-(ethylsulfamoyl)-2-(2-phenyl-1,3-thiazol-4-yl)ethanamine (PubChem CID 110624843) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is N-(ethylsulfamoyl)-2-(2-phenyl-1,3-thiazol-4-yl)ethanamine.
| Compound Name | N-(ethylsulfamoyl)-2-(2-phenyl-1,3-thiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 110624843 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-(ethylsulfamoyl)-2-(2-phenyl-1,3-thiazol-4-yl)ethanamine |
| SMILES | CCNS(=O)(=O)NCCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C13H17N3O2S2/c1-2-14-20(17,18)15-9-8-12-10-19-13(16-12)11-6-4-3-5-7-11/h3-7,10,14-15H,2,8-9H2,1H3 |
| InChIKey | XAHCYDHVMIXDLH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |