C14H18N2O3S2 — CID 110305114
2-methoxy-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]ethanesulfonamide (PubChem CID 110305114) has the molecular formula C14H18N2O3S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-methoxy-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]ethanesulfonamide.
| Compound Name | 2-methoxy-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 110305114 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-methoxy-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]ethanesulfonamide |
| SMILES | COCCS(=O)(=O)NCCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H18N2O3S2/c1-19-9-10-21(17,18)15-8-7-13-11-20-14(16-13)12-5-3-2-4-6-12/h2-6,11,15H,7-10H2,1H3 |
| InChIKey | NEMCSILAUMLYPP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |