C15H19ClN2O2S2 — CID 110284947
N-[2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]ethyl]butane-1-sulfonamide (PubChem CID 110284947) has the molecular formula C15H19ClN2O2S2 and a molecular weight of 358.92 g/mol. Its IUPAC name is N-[2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]ethyl]butane-1-sulfonamide.
| Compound Name | N-[2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 110284947 |
| Molecular Formula | C15H19ClN2O2S2 |
| Molecular Weight | 358.92 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]ethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCCc1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C15H19ClN2O2S2/c1-2-3-10-22(19,20)17-9-8-12-11-21-15(18-12)13-6-4-5-7-14(13)16/h4-7,11,17H,2-3,8-10H2,1H3 |
| InChIKey | QSIZSHPSIYYOHR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.92 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |