C16H20ClN3O2S2 — CID 110624868
N-[2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]ethylsulfamoyl]cyclopentanamine (PubChem CID 110624868) has the molecular formula C16H20ClN3O2S2 and a molecular weight of 385.94 g/mol. Its IUPAC name is N-[2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]ethylsulfamoyl]cyclopentanamine.
| Compound Name | N-[2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]ethylsulfamoyl]cyclopentanamine |
|---|---|
| PubChem CID | 110624868 |
| Molecular Formula | C16H20ClN3O2S2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]ethylsulfamoyl]cyclopentanamine |
| SMILES | O=S(=O)(NCCc1csc(-c2ccccc2Cl)n1)NC1CCCC1 |
| InChI | InChI=1S/C16H20ClN3O2S2/c17-15-8-4-3-7-14(15)16-19-13(11-23-16)9-10-18-24(21,22)20-12-5-1-2-6-12/h3-4,7-8,11-12,18,20H,1-2,5-6,9-10H2 |
| InChIKey | PFLCORKEKBGGNW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |