C13H18Cl2N2O2S — CID 47148941
N-[2-(2,4-dichlorophenyl)ethyl]piperidine-1-sulfonamide (PubChem CID 47148941) has the molecular formula C13H18Cl2N2O2S and a molecular weight of 337.27 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]piperidine-1-sulfonamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 47148941 |
| Molecular Formula | C13H18Cl2N2O2S |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]piperidine-1-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(Cl)cc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C13H18Cl2N2O2S/c14-12-5-4-11(13(15)10-12)6-7-16-20(18,19)17-8-2-1-3-9-17/h4-5,10,16H,1-3,6-9H2 |
| InChIKey | AFMPCIKCLVXSOT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |