C14H13Cl2NO3S — CID 81264913
N-[2-(2,4-dichlorophenyl)ethyl]-3-hydroxybenzenesulfonamide (PubChem CID 81264913) has the molecular formula C14H13Cl2NO3S and a molecular weight of 346.24 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-3-hydroxybenzenesulfonamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 81264913 |
| Molecular Formula | C14H13Cl2NO3S |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(Cl)cc1Cl)c1cccc(O)c1 |
| InChI | InChI=1S/C14H13Cl2NO3S/c15-11-5-4-10(14(16)8-11)6-7-17-21(19,20)13-3-1-2-12(18)9-13/h1-5,8-9,17-18H,6-7H2 |
| InChIKey | FFUGQKKKMGUIKD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |