C22H23N3O5S — CID 126478720
N-(1,3-benzothiazol-2-ylmethyl)-2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid (PubChem CID 126478720) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid |
|---|---|
| PubChem CID | 126478720 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid |
| SMILES | COc1ccc2[nH]c(C)c(CCNCc3nc4ccccc4s3)c2c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H21N3OS.C2H2O4/c1-13-15(16-11-14(24-2)7-8-17(16)22-13)9-10-21-12-20-23-18-5-3-4-6-19(18)25-20;3-1(4)2(5)6/h3-8,11,21-22H,9-10,12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | SJVVXDJFKAYFCI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|