C22H25N3O3S — CID 16798357
1-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(2,4-dimethylphenyl)thiourea (PubChem CID 16798357) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(2,4-dimethylphenyl)thiourea.
| Compound Name | 1-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(2,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 16798357 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(2,4-dimethylphenyl)thiourea |
| SMILES | COc1ccc(OC)c2[nH]c(=O)c(CCNC(=S)Nc3ccc(C)cc3C)cc12 |
| InChI | InChI=1S/C22H25N3O3S/c1-13-5-6-17(14(2)11-13)24-22(29)23-10-9-15-12-16-18(27-3)7-8-19(28-4)20(16)25-21(15)26/h5-8,11-12H,9-10H2,1-4H3,(H,25,26)(H2,23,24,29) |
| InChIKey | AZRFJLMWAXQNRX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|