C15H17ClN2O4 — CID 7136765
2-chloro-N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]acetamide (PubChem CID 7136765) has the molecular formula C15H17ClN2O4 and a molecular weight of 324.76 g/mol. Its IUPAC name is 2-chloro-N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 7136765 |
| Molecular Formula | C15H17ClN2O4 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-chloro-N-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]acetamide |
| SMILES | COc1ccc(OC)c2[nH]c(=O)c(CCNC(=O)CCl)cc12 |
| InChI | InChI=1S/C15H17ClN2O4/c1-21-11-3-4-12(22-2)14-10(11)7-9(15(20)18-14)5-6-17-13(19)8-16/h3-4,7H,5-6,8H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | CXHPKQVMSOWZIJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|