C20H20FN3O3S — CID 7137035
1-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(4-fluorophenyl)thiourea (PubChem CID 7137035) has the molecular formula C20H20FN3O3S and a molecular weight of 401.46 g/mol. Its IUPAC name is 1-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 7137035 |
| Molecular Formula | C20H20FN3O3S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 1-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(4-fluorophenyl)thiourea |
| SMILES | COc1ccc(OC)c2[nH]c(=O)c(CCNC(=S)Nc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C20H20FN3O3S/c1-26-16-7-8-17(27-2)18-15(16)11-12(19(25)24-18)9-10-22-20(28)23-14-5-3-13(21)4-6-14/h3-8,11H,9-10H2,1-2H3,(H,24,25)(H2,22,23,28) |
| InChIKey | ZVGQBJDEFVTKOL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|