C17H23N3O4S — CID 7080770
1-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(2-methoxyethyl)thiourea (PubChem CID 7080770) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 7080770 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-[2-(5,8-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NCCc1cc2c(OC)ccc(OC)c2[nH]c1=O |
| InChI | InChI=1S/C17H23N3O4S/c1-22-9-8-19-17(25)18-7-6-11-10-12-13(23-2)4-5-14(24-3)15(12)20-16(11)21/h4-5,10H,6-9H2,1-3H3,(H,20,21)(H2,18,19,25) |
| InChIKey | UUZBPQCXDJKCPJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|