C21H26N8O2S — CID 17089225
1-(2,5-dimethoxyphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]thiourea (PubChem CID 17089225) has the molecular formula C21H26N8O2S and a molecular weight of 454.56 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]thiourea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17089225 |
| Molecular Formula | C21H26N8O2S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-imidazol-5-yl)ethyl]carbamimidoyl]thiourea |
| SMILES | COc1ccc(OC)c(NC(=S)N/C(=N/CCc2cnc[nH]2)Nc2nc(C)cc(C)n2)c1 |
| InChI | InChI=1S/C21H26N8O2S/c1-13-9-14(2)26-20(25-13)28-19(23-8-7-15-11-22-12-24-15)29-21(32)27-17-10-16(30-3)5-6-18(17)31-4/h5-6,9-12H,7-8H2,1-4H3,(H,22,24)(H3,23,25,26,27,28,29,32) |
| InChIKey | XXPQXTHCTDXMGM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|