C19H16F5N5O — CID 58039396
2-N-[(2-fluorophenyl)methyl]-4-N-[(4-fluorophenyl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 58039396) has the molecular formula C19H16F5N5O and a molecular weight of 425.36 g/mol. Its IUPAC name is 2-N-[(2-fluorophenyl)methyl]-4-N-[(4-fluorophenyl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(2-fluorophenyl)methyl]-4-N-[(4-fluorophenyl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58039396 |
| Molecular Formula | C19H16F5N5O |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-N-[(2-fluorophenyl)methyl]-4-N-[(4-fluorophenyl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | Fc1ccc(CNc2nc(NCc3ccccc3F)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C19H16F5N5O/c20-14-7-5-12(6-8-14)9-25-16-27-17(26-10-13-3-1-2-4-15(13)21)29-18(28-16)30-11-19(22,23)24/h1-8H,9-11H2,(H2,25,26,27,28,29) |
| InChIKey | DXXZKSRQXFJBDI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |