C13H9ClFN5 — CID 82459730
4-chloro-N-[(2-fluorophenyl)methyl]pteridin-2-amine (PubChem CID 82459730) has the molecular formula C13H9ClFN5 and a molecular weight of 289.70 g/mol. Its IUPAC name is 4-chloro-N-[(2-fluorophenyl)methyl]pteridin-2-amine.
| Compound Name | 4-chloro-N-[(2-fluorophenyl)methyl]pteridin-2-amine |
|---|---|
| PubChem CID | 82459730 |
| Molecular Formula | C13H9ClFN5 |
| Molecular Weight | 289.70 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 4-chloro-N-[(2-fluorophenyl)methyl]pteridin-2-amine |
| SMILES | Fc1ccccc1CNc1nc(Cl)c2nccnc2n1 |
| InChI | InChI=1S/C13H9ClFN5/c14-11-10-12(17-6-5-16-10)20-13(19-11)18-7-8-3-1-2-4-9(8)15/h1-6H,7H2,(H,17,18,19,20) |
| InChIKey | YRPKZNKSNXUTCA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |