C17H15F3N4O6 — CID 4216992
2-methoxy-4-nitro-6-[2-[4-nitro-2-(trifluoromethyl)anilino]ethyliminomethyl]phenol (PubChem CID 4216992) has the molecular formula C17H15F3N4O6 and a molecular weight of 428.32 g/mol. Its IUPAC name is 2-methoxy-4-nitro-6-[2-[4-nitro-2-(trifluoromethyl)anilino]ethyliminomethyl]phenol.
| Compound Name | 2-methoxy-4-nitro-6-[2-[4-nitro-2-(trifluoromethyl)anilino]ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 4216992 |
| Molecular Formula | C17H15F3N4O6 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-methoxy-4-nitro-6-[2-[4-nitro-2-(trifluoromethyl)anilino]ethyliminomethyl]phenol |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=N/CCNc2ccc([N+](=O)[O-])cc2C(F)(F)F)c1O |
| InChI | InChI=1S/C17H15F3N4O6/c1-30-15-8-12(24(28)29)6-10(16(15)25)9-21-4-5-22-14-3-2-11(23(26)27)7-13(14)17(18,19)20/h2-3,6-9,22,25H,4-5H2,1H3/b21-9+ |
| InChIKey | NKQOHIQCOZZWKW-ZVBGSRNCSA-N |
| XLogP | 3.77 |
| TPSA | 140.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|