C28H18Cl2N2O4 — CID 3584207
(2,5-dichlorophenyl) 4-[[4-hydroxy-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]benzoate (PubChem CID 3584207) has the molecular formula C28H18Cl2N2O4 and a molecular weight of 517.37 g/mol. Its IUPAC name is (2,5-dichlorophenyl) 4-[[4-hydroxy-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]benzoate.
| Compound Name | (2,5-dichlorophenyl) 4-[[4-hydroxy-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 3584207 |
| Molecular Formula | C28H18Cl2N2O4 |
| Molecular Weight | 517.37 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | (2,5-dichlorophenyl) 4-[[4-hydroxy-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]benzoate |
| SMILES | Cc1ccc2nc(-c3cc(/N=C/c4ccc(C(=O)Oc5cc(Cl)ccc5Cl)cc4)ccc3O)oc2c1 |
| InChI | InChI=1S/C28H18Cl2N2O4/c1-16-2-10-23-26(12-16)35-27(32-23)21-14-20(8-11-24(21)33)31-15-17-3-5-18(6-4-17)28(34)36-25-13-19(29)7-9-22(25)30/h2-15,33H,1H3/b31-15+ |
| InChIKey | AVDFKEYQJJDJHG-IBBHUPRXSA-N |
| XLogP | 7.79 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.37 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|