C20H12F3N3OS — CID 137078966
2-(1,3-benzothiazol-2-yl)-4-[[3-(trifluoromethyl)phenyl]diazenyl]phenol (PubChem CID 137078966) has the molecular formula C20H12F3N3OS and a molecular weight of 399.40 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4-[[3-(trifluoromethyl)phenyl]diazenyl]phenol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4-[[3-(trifluoromethyl)phenyl]diazenyl]phenol |
|---|---|
| PubChem CID | 137078966 |
| Molecular Formula | C20H12F3N3OS |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4-[[3-(trifluoromethyl)phenyl]diazenyl]phenol |
| SMILES | Oc1ccc(/N=N/c2cccc(C(F)(F)F)c2)cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H12F3N3OS/c21-20(22,23)12-4-3-5-13(10-12)25-26-14-8-9-17(27)15(11-14)19-24-16-6-1-2-7-18(16)28-19/h1-11,27H/b26-25+ |
| InChIKey | SUXCQMSJXRDUSC-OCEACIFDSA-N |
| XLogP | 7.10 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|