C38H27N4O2PS2Zn — CID 135981535
2-(1,3-benzothiazol-2-yl)-4-(N-phenylanilino)phenol;2-(1,3-benzothiazol-2-yl)-4-(phosphanylideneamino)phenol;zinc (PubChem CID 135981535) has the molecular formula C38H27N4O2PS2Zn and a molecular weight of 732.16 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4-(N-phenylanilino)phenol;2-(1,3-benzothiazol-2-yl)-4-(phosphanylideneamino)phenol;zinc.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4-(N-phenylanilino)phenol;2-(1,3-benzothiazol-2-yl)-4-(phosphanylideneamino)phenol;zinc |
|---|---|
| PubChem CID | 135981535 |
| Molecular Formula | C38H27N4O2PS2Zn |
| Molecular Weight | 732.16 g/mol |
| Exact Mass | 730.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4-(N-phenylanilino)phenol;2-(1,3-benzothiazol-2-yl)-4-(phosphanylideneamino)phenol;zinc |
| SMILES | Oc1ccc(N(c2ccccc2)c2ccccc2)cc1-c1nc2ccccc2s1.[H]/P=N/c1ccc(O)c(-c2nc3ccccc3s2)c1.[Zn] |
| InChI | InChI=1S/C25H18N2OS.C13H9N2OPS.Zn/c28-23-16-15-20(17-21(23)25-26-22-13-7-8-14-24(22)29-25)27(18-9-3-1-4-10-18)19-11-5-2-6-12-19;16-11-6-5-8(15-17)7-9(11)13-14-10-3-1-2-4-12(10)18-13;/h1-17,28H;1-7,16-17H; |
| InChIKey | VJLVNJASHWLCOG-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.16 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|