C25H17N3OS — CID 174787290
2-[5-(4-phenyldiazenylphenyl)-1,3-benzothiazol-2-yl]phenol (PubChem CID 174787290) has the molecular formula C25H17N3OS and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-[5-(4-phenyldiazenylphenyl)-1,3-benzothiazol-2-yl]phenol.
| Compound Name | 2-[5-(4-phenyldiazenylphenyl)-1,3-benzothiazol-2-yl]phenol |
|---|---|
| PubChem CID | 174787290 |
| Molecular Formula | C25H17N3OS |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-[5-(4-phenyldiazenylphenyl)-1,3-benzothiazol-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nc2cc(-c3ccc(/N=N/c4ccccc4)cc3)ccc2s1 |
| InChI | InChI=1S/C25H17N3OS/c29-23-9-5-4-8-21(23)25-26-22-16-18(12-15-24(22)30-25)17-10-13-20(14-11-17)28-27-19-6-2-1-3-7-19/h1-16,29H/b28-27+ |
| InChIKey | HBVMKYHCYGVVCB-BYYHNAKLSA-N |
| XLogP | 7.75 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|