C50H32N4S — CID 163738860
5-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2-(4-naphthalen-1-ylphenyl)-1,3-benzothiazole (PubChem CID 163738860) has the molecular formula C50H32N4S and a molecular weight of 720.90 g/mol. Its IUPAC name is 5-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2-(4-naphthalen-1-ylphenyl)-1,3-benzothiazole.
| Compound Name | 5-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2-(4-naphthalen-1-ylphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 163738860 |
| Molecular Formula | C50H32N4S |
| Molecular Weight | 720.90 g/mol |
| Exact Mass | 720.23 |
| IUPAC Name | 5-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2-(4-naphthalen-1-ylphenyl)-1,3-benzothiazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc5sc(-c6ccc(-c7cccc8ccccc78)cc6)nc5c4)n3)cc2)cc1 |
| InChI | InChI=1S/C50H32N4S/c1-3-10-33(11-4-1)35-18-24-39(25-19-35)47-52-48(40-26-20-36(21-27-40)34-12-5-2-6-13-34)54-49(53-47)42-30-31-46-45(32-42)51-50(55-46)41-28-22-38(23-29-41)44-17-9-15-37-14-7-8-16-43(37)44/h1-32H |
| InChIKey | LFZYOVCJSWCIJQ-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.90 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |