C22H17BrN2O2S — CID 3096197
2-[[3-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-4-bromo-6-ethoxyphenol (PubChem CID 3096197) has the molecular formula C22H17BrN2O2S and a molecular weight of 453.36 g/mol. Its IUPAC name is 2-[[3-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-4-bromo-6-ethoxyphenol.
| Compound Name | 2-[[3-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-4-bromo-6-ethoxyphenol |
|---|---|
| PubChem CID | 3096197 |
| Molecular Formula | C22H17BrN2O2S |
| Molecular Weight | 453.36 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 2-[[3-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]-4-bromo-6-ethoxyphenol |
| SMILES | CCOc1cc(Br)cc(/C=N/c2cccc(-c3nc4ccccc4s3)c2)c1O |
| InChI | InChI=1S/C22H17BrN2O2S/c1-2-27-19-12-16(23)10-15(21(19)26)13-24-17-7-5-6-14(11-17)22-25-18-8-3-4-9-20(18)28-22/h3-13,26H,2H2,1H3/b24-13+ |
| InChIKey | AJIDKWYWQNFWQL-ZMOGYAJESA-N |
| XLogP | 6.58 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.36 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|