C23H20Br2N2O3 — CID 3098933
3-bromo-N-[3-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]phenyl]-4-methylbenzamide (PubChem CID 3098933) has the molecular formula C23H20Br2N2O3 and a molecular weight of 532.23 g/mol. Its IUPAC name is 3-bromo-N-[3-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]phenyl]-4-methylbenzamide.
| Compound Name | 3-bromo-N-[3-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 3098933 |
| Molecular Formula | C23H20Br2N2O3 |
| Molecular Weight | 532.23 g/mol |
| Exact Mass | 529.98 |
| IUPAC Name | 3-bromo-N-[3-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylideneamino]phenyl]-4-methylbenzamide |
| SMILES | CCOc1cc(Br)cc(/C=N/c2cccc(NC(=O)c3ccc(C)c(Br)c3)c2)c1O |
| InChI | InChI=1S/C23H20Br2N2O3/c1-3-30-21-11-17(24)9-16(22(21)28)13-26-18-5-4-6-19(12-18)27-23(29)15-8-7-14(2)20(25)10-15/h4-13,28H,3H2,1-2H3,(H,27,29)/b26-13+ |
| InChIKey | ZGBDBMNAVDPHIX-LGJNPRDNSA-N |
| XLogP | 6.63 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.23 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|