C16H18N2O4S — CID 135855210
5-[(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-methylbenzenesulfonamide (PubChem CID 135855210) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 5-[(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-methylbenzenesulfonamide.
| Compound Name | 5-[(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135855210 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 5-[(3-ethoxy-2-hydroxyphenyl)methylideneamino]-2-methylbenzenesulfonamide |
| SMILES | CCOc1cccc(/C=N/c2ccc(C)c(S(N)(=O)=O)c2)c1O |
| InChI | InChI=1S/C16H18N2O4S/c1-3-22-14-6-4-5-12(16(14)19)10-18-13-8-7-11(2)15(9-13)23(17,20)21/h4-10,19H,3H2,1-2H3,(H2,17,20,21)/b18-10+ |
| InChIKey | BQUJYGOZIHGBDW-VCHYOVAHSA-N |
| XLogP | 2.50 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|