C20H23BrN2O3 — CID 17197037
3-bromo-N-[3-(butylcarbamoyl)phenyl]-4-ethoxybenzamide (PubChem CID 17197037) has the molecular formula C20H23BrN2O3 and a molecular weight of 419.32 g/mol. Its IUPAC name is 3-bromo-N-[3-(butylcarbamoyl)phenyl]-4-ethoxybenzamide.
| Compound Name | 3-bromo-N-[3-(butylcarbamoyl)phenyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 17197037 |
| Molecular Formula | C20H23BrN2O3 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 3-bromo-N-[3-(butylcarbamoyl)phenyl]-4-ethoxybenzamide |
| SMILES | CCCCNC(=O)c1cccc(NC(=O)c2ccc(OCC)c(Br)c2)c1 |
| InChI | InChI=1S/C20H23BrN2O3/c1-3-5-11-22-19(24)14-7-6-8-16(12-14)23-20(25)15-9-10-18(26-4-2)17(21)13-15/h6-10,12-13H,3-5,11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | HBTTZSGUDMXBTL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|