C24H30BrN3O3S — CID 17197282
3-bromo-N-[[3-(butylcarbamoyl)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide (PubChem CID 17197282) has the molecular formula C24H30BrN3O3S and a molecular weight of 520.49 g/mol. Its IUPAC name is 3-bromo-N-[[3-(butylcarbamoyl)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide.
| Compound Name | 3-bromo-N-[[3-(butylcarbamoyl)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17197282 |
| Molecular Formula | C24H30BrN3O3S |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | 3-bromo-N-[[3-(butylcarbamoyl)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
| SMILES | CCCCNC(=O)c1cccc(NC(=S)NC(=O)c2ccc(OCCC(C)C)c(Br)c2)c1 |
| InChI | InChI=1S/C24H30BrN3O3S/c1-4-5-12-26-22(29)17-7-6-8-19(14-17)27-24(32)28-23(30)18-9-10-21(20(25)15-18)31-13-11-16(2)3/h6-10,14-16H,4-5,11-13H2,1-3H3,(H,26,29)(H2,27,28,30,32) |
| InChIKey | JFGHIZFXVSYHFN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|