C27H28BrN3O3S — CID 43887161
N-[[3-(benzylcarbamoyl)phenyl]carbamothioyl]-3-bromo-4-(3-methylbutoxy)benzamide (PubChem CID 43887161) has the molecular formula C27H28BrN3O3S and a molecular weight of 554.51 g/mol. Its IUPAC name is N-[[3-(benzylcarbamoyl)phenyl]carbamothioyl]-3-bromo-4-(3-methylbutoxy)benzamide.
| Compound Name | N-[[3-(benzylcarbamoyl)phenyl]carbamothioyl]-3-bromo-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 43887161 |
| Molecular Formula | C27H28BrN3O3S |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | N-[[3-(benzylcarbamoyl)phenyl]carbamothioyl]-3-bromo-4-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC(=S)Nc2cccc(C(=O)NCc3ccccc3)c2)cc1Br |
| InChI | InChI=1S/C27H28BrN3O3S/c1-18(2)13-14-34-24-12-11-21(16-23(24)28)26(33)31-27(35)30-22-10-6-9-20(15-22)25(32)29-17-19-7-4-3-5-8-19/h3-12,15-16,18H,13-14,17H2,1-2H3,(H,29,32)(H2,30,31,33,35) |
| InChIKey | UWFMGEXUUBVQSB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|