C25H30BrN3O4S — CID 17202687
3-bromo-4-(3-methylbutoxy)-N-[[3-(oxolan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 17202687) has the molecular formula C25H30BrN3O4S and a molecular weight of 548.50 g/mol. Its IUPAC name is 3-bromo-4-(3-methylbutoxy)-N-[[3-(oxolan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-(3-methylbutoxy)-N-[[3-(oxolan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17202687 |
| Molecular Formula | C25H30BrN3O4S |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | 3-bromo-4-(3-methylbutoxy)-N-[[3-(oxolan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC(=S)Nc2cccc(C(=O)NCC3CCCO3)c2)cc1Br |
| InChI | InChI=1S/C25H30BrN3O4S/c1-16(2)10-12-33-22-9-8-18(14-21(22)26)24(31)29-25(34)28-19-6-3-5-17(13-19)23(30)27-15-20-7-4-11-32-20/h3,5-6,8-9,13-14,16,20H,4,7,10-12,15H2,1-2H3,(H,27,30)(H2,28,29,31,34) |
| InChIKey | CWQOBZNQPRRWHC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|