C25H19N3O5 — CID 135890916
2-hydroxy-N-[(Z)-(2-hydroxy-6-nitronaphthalen-1-yl)methylideneamino]-2,2-diphenylacetamide (PubChem CID 135890916) has the molecular formula C25H19N3O5 and a molecular weight of 441.44 g/mol. Its IUPAC name is 2-hydroxy-N-[(Z)-(2-hydroxy-6-nitronaphthalen-1-yl)methylideneamino]-2,2-diphenylacetamide.
| Compound Name | 2-hydroxy-N-[(Z)-(2-hydroxy-6-nitronaphthalen-1-yl)methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 135890916 |
| Molecular Formula | C25H19N3O5 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-hydroxy-N-[(Z)-(2-hydroxy-6-nitronaphthalen-1-yl)methylideneamino]-2,2-diphenylacetamide |
| SMILES | O=C(N/N=C\c1c(O)ccc2cc([N+](=O)[O-])ccc12)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H19N3O5/c29-23-14-11-17-15-20(28(32)33)12-13-21(17)22(23)16-26-27-24(30)25(31,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-16,29,31H,(H,27,30)/b26-16- |
| InChIKey | FXTKOBJHOJYJHK-QQXSKIMKSA-N |
| XLogP | 3.84 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|