C22H24N8O3 — CID 4166602
1-[[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitronaphthalen-2-ol (PubChem CID 4166602) has the molecular formula C22H24N8O3 and a molecular weight of 448.49 g/mol. Its IUPAC name is 1-[[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitronaphthalen-2-ol.
| Compound Name | 1-[[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitronaphthalen-2-ol |
|---|---|
| PubChem CID | 4166602 |
| Molecular Formula | C22H24N8O3 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 1-[[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitronaphthalen-2-ol |
| SMILES | O=[N+]([O-])c1ccc2c(C=NNc3nc(N4CCCC4)nc(N4CCCC4)n3)c(O)ccc2c1 |
| InChI | InChI=1S/C22H24N8O3/c31-19-8-5-15-13-16(30(32)33)6-7-17(15)18(19)14-23-27-20-24-21(28-9-1-2-10-28)26-22(25-20)29-11-3-4-12-29/h5-8,13-14,31H,1-4,9-12H2,(H,24,25,26,27) |
| InChIKey | FZSGQNLLXRQFBT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|