C16H9N3O5 — CID 137155312
2-[5-(5-nitro-1-benzofuran-2-yl)-1,3,4-oxadiazol-2-yl]phenol (PubChem CID 137155312) has the molecular formula C16H9N3O5 and a molecular weight of 323.26 g/mol. Its IUPAC name is 2-[5-(5-nitro-1-benzofuran-2-yl)-1,3,4-oxadiazol-2-yl]phenol.
| Compound Name | 2-[5-(5-nitro-1-benzofuran-2-yl)-1,3,4-oxadiazol-2-yl]phenol |
|---|---|
| PubChem CID | 137155312 |
| Molecular Formula | C16H9N3O5 |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-[5-(5-nitro-1-benzofuran-2-yl)-1,3,4-oxadiazol-2-yl]phenol |
| SMILES | O=[N+]([O-])c1ccc2oc(-c3nnc(-c4ccccc4O)o3)cc2c1 |
| InChI | InChI=1S/C16H9N3O5/c20-12-4-2-1-3-11(12)15-17-18-16(24-15)14-8-9-7-10(19(21)22)5-6-13(9)23-14/h1-8,20H |
| InChIKey | VYGWYGZPUSMTQY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|