C14H9N3O4 — CID 135511712
2-(4-imino-6-nitro-3,1-benzoxazin-2-yl)phenol (PubChem CID 135511712) has the molecular formula C14H9N3O4 and a molecular weight of 283.24 g/mol. Its IUPAC name is 2-(4-imino-6-nitro-3,1-benzoxazin-2-yl)phenol.
| Compound Name | 2-(4-imino-6-nitro-3,1-benzoxazin-2-yl)phenol |
|---|---|
| PubChem CID | 135511712 |
| Molecular Formula | C14H9N3O4 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-(4-imino-6-nitro-3,1-benzoxazin-2-yl)phenol |
| SMILES | [H]/N=c1\oc(-c2ccccc2O)nc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C14H9N3O4/c15-13-10-7-8(17(19)20)5-6-11(10)16-14(21-13)9-3-1-2-4-12(9)18/h1-7,15,18H/b15-13- |
| InChIKey | NVCUOQMLAVILQU-SQFISAMPSA-N |
| XLogP | 2.59 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|