C21H15ClN2O4 — CID 135882421
2-(6-nitro-4-phenylquinolin-2-yl)benzene-1,4-diol;hydrochloride (PubChem CID 135882421) has the molecular formula C21H15ClN2O4 and a molecular weight of 394.81 g/mol. Its IUPAC name is 2-(6-nitro-4-phenylquinolin-2-yl)benzene-1,4-diol;hydrochloride.
| Compound Name | 2-(6-nitro-4-phenylquinolin-2-yl)benzene-1,4-diol;hydrochloride |
|---|---|
| PubChem CID | 135882421 |
| Molecular Formula | C21H15ClN2O4 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-(6-nitro-4-phenylquinolin-2-yl)benzene-1,4-diol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2nc(-c3cc(O)ccc3O)cc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C21H14N2O4.ClH/c24-15-7-9-21(25)18(11-15)20-12-16(13-4-2-1-3-5-13)17-10-14(23(26)27)6-8-19(17)22-20;/h1-12,24-25H;1H |
| InChIKey | UFKQLRZLBACGJI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|