C18H11N3O2S — CID 166203216
2-(6-nitro-4-phenylquinolin-2-yl)-1,3-thiazole (PubChem CID 166203216) has the molecular formula C18H11N3O2S and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-(6-nitro-4-phenylquinolin-2-yl)-1,3-thiazole.
| Compound Name | 2-(6-nitro-4-phenylquinolin-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 166203216 |
| Molecular Formula | C18H11N3O2S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 2-(6-nitro-4-phenylquinolin-2-yl)-1,3-thiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(-c3nccs3)cc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C18H11N3O2S/c22-21(23)13-6-7-16-15(10-13)14(12-4-2-1-3-5-12)11-17(20-16)18-19-8-9-24-18/h1-11H |
| InChIKey | COJGNJYNXACWEO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|