C10H6N4O3S — CID 10332908
2-(1-hydroxy-6-nitrobenzimidazol-2-yl)-1,3-thiazole (PubChem CID 10332908) has the molecular formula C10H6N4O3S and a molecular weight of 262.25 g/mol. Its IUPAC name is 2-(1-hydroxy-6-nitrobenzimidazol-2-yl)-1,3-thiazole.
| Compound Name | 2-(1-hydroxy-6-nitrobenzimidazol-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 10332908 |
| Molecular Formula | C10H6N4O3S |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 2-(1-hydroxy-6-nitrobenzimidazol-2-yl)-1,3-thiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(-c3nccs3)n(O)c2c1 |
| InChI | InChI=1S/C10H6N4O3S/c15-13-8-5-6(14(16)17)1-2-7(8)12-9(13)10-11-3-4-18-10/h1-5,15H |
| InChIKey | SYQCZCFSVQXWLK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|